C24H25Cl2NO5 — CID 21175978
[2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]cyclohexane-1-carboxylate (PubChem CID 21175978) has the molecular formula C24H25Cl2NO5 and a molecular weight of 478.37 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]cyclohexane-1-carboxylate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 21175978 |
| Molecular Formula | C24H25Cl2NO5 |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]cyclohexane-1-carboxylate |
| SMILES | O=C(COC(=O)C1CCC(N2C(=O)[C@@H]3[C@@H]4CC[C@H](C4)[C@@H]3C2=O)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H25Cl2NO5/c25-15-5-8-17(18(26)10-15)19(28)11-32-24(31)12-3-6-16(7-4-12)27-22(29)20-13-1-2-14(9-13)21(20)23(27)30/h5,8,10,12-14,16,20-21H,1-4,6-7,9,11H2/t12?,13-,14-,16?,20-,21+/m1/s1 |
| InChIKey | GCBVSFUWLHVUAY-UAWWDEGYSA-N |
| XLogP | 4.31 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|