C33H24Cl2N2O5 — CID 98280177
[2-(2,4-dichlorophenyl)-2-oxoethyl] 2-[3-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate (PubChem CID 98280177) has the molecular formula C33H24Cl2N2O5 and a molecular weight of 599.47 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 2-[3-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 2-[3-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 98280177 |
| Molecular Formula | C33H24Cl2N2O5 |
| Molecular Weight | 599.47 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 2-[3-[(1S,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2cccc(N3C(=O)[C@@H]4[C@H]5CC[C@@H](C5)[C@H]4C3=O)c2)nc2ccccc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H24Cl2N2O5/c34-20-10-11-23(25(35)14-20)28(38)16-42-33(41)24-15-27(36-26-7-2-1-6-22(24)26)17-4-3-5-21(13-17)37-31(39)29-18-8-9-19(12-18)30(29)32(37)40/h1-7,10-11,13-15,18-19,29-30H,8-9,12,16H2/t18-,19-,29+,30+/m0/s1 |
| InChIKey | FJTAXBPPRKLPCM-AOQKOQKVSA-N |
| XLogP | 6.78 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.47 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|