C33H25ClN2O5 — CID 98320311
[2-(4-chlorophenyl)-2-oxoethyl] 2-[3-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate (PubChem CID 98320311) has the molecular formula C33H25ClN2O5 and a molecular weight of 565.03 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 2-[3-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[3-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 98320311 |
| Molecular Formula | C33H25ClN2O5 |
| Molecular Weight | 565.03 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[3-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl]quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2cccc(N3C(=O)[C@H]4[C@@H]5CC[C@@H](C5)[C@@H]4C3=O)c2)nc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H25ClN2O5/c34-22-12-10-18(11-13-22)28(37)17-41-33(40)25-16-27(35-26-7-2-1-6-24(25)26)19-4-3-5-23(15-19)36-31(38)29-20-8-9-21(14-20)30(29)32(36)39/h1-7,10-13,15-16,20-21,29-30H,8-9,14,17H2/t20-,21+,29-,30-/m0/s1 |
| InChIKey | UTWDZFFXKMLBFV-JPNDCQDCSA-N |
| XLogP | 6.13 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.03 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|