C33H25ClN2O5 — CID 98106574
[2-(4-chlorophenyl)-2-oxoethyl] 2-[4-[(3aR,4S,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate (PubChem CID 98106574) has the molecular formula C33H25ClN2O5 and a molecular weight of 565.03 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 2-[4-[(3aR,4S,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[4-[(3aR,4S,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 98106574 |
| Molecular Formula | C33H25ClN2O5 |
| Molecular Weight | 565.03 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[4-[(3aR,4S,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate |
| SMILES | C[C@H]1C=CC[C@H]2C(=O)N(c3ccc(-c4cc(C(=O)OCC(=O)c5ccc(Cl)cc5)c5ccccc5n4)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C33H25ClN2O5/c1-19-5-4-7-25-30(19)32(39)36(31(25)38)23-15-11-20(12-16-23)28-17-26(24-6-2-3-8-27(24)35-28)33(40)41-18-29(37)21-9-13-22(34)14-10-21/h2-6,8-17,19,25,30H,7,18H2,1H3/t19-,25+,30+/m0/s1 |
| InChIKey | ZRNABWVVPBFNEU-JDFKUVRLSA-N |
| XLogP | 6.30 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.03 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|