C39H30N2O5 — CID 3325706
[2-oxo-2-(4-phenylphenyl)ethyl] 2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3325706) has the molecular formula C39H30N2O5 and a molecular weight of 606.68 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3325706 |
| Molecular Formula | C39H30N2O5 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC1C=CCC2C(=O)N(c3ccc(-c4cc(C(=O)OCC(=O)c5ccc(-c6ccccc6)cc5)c5ccccc5n4)cc3)C(=O)C12 |
| InChI | InChI=1S/C39H30N2O5/c1-24-8-7-12-31-36(24)38(44)41(37(31)43)29-20-18-27(19-21-29)34-22-32(30-11-5-6-13-33(30)40-34)39(45)46-23-35(42)28-16-14-26(15-17-28)25-9-3-2-4-10-25/h2-11,13-22,24,31,36H,12,23H2,1H3 |
| InChIKey | OGDIEXUDCRWAHX-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|