C33H26N2O6 — CID 3272175
[2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3272175) has the molecular formula C33H26N2O6 and a molecular weight of 546.58 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3272175 |
| Molecular Formula | C33H26N2O6 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | COc1cccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)C5CC=CCC5C4=O)cc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C33H26N2O6/c1-40-23-8-6-7-21(17-23)30(36)19-41-33(39)27-18-29(34-28-12-5-4-9-24(27)28)20-13-15-22(16-14-20)35-31(37)25-10-2-3-11-26(25)32(35)38/h2-9,12-18,25-26H,10-11,19H2,1H3 |
| InChIKey | SRSRVHOPIBXSHL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|