C33H25BrN2O6 — CID 99656846
[2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-6-bromoquinoline-4-carboxylate (PubChem CID 99656846) has the molecular formula C33H25BrN2O6 and a molecular weight of 625.48 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-6-bromoquinoline-4-carboxylate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-6-bromoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 99656846 |
| Molecular Formula | C33H25BrN2O6 |
| Molecular Weight | 625.48 g/mol |
| Exact Mass | 624.09 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-6-bromoquinoline-4-carboxylate |
| SMILES | COc1cccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)[C@@H]5CC=CC[C@H]5C4=O)cc3)nc3ccc(Br)cc23)c1 |
| InChI | InChI=1S/C33H25BrN2O6/c1-41-23-6-4-5-20(15-23)30(37)18-42-33(40)27-17-29(35-28-14-11-21(34)16-26(27)28)19-9-12-22(13-10-19)36-31(38)24-7-2-3-8-25(24)32(36)39/h2-6,9-17,24-25H,7-8,18H2,1H3/t24-,25-/m1/s1 |
| InChIKey | RCNQDILCZIEDJZ-JWQCQUIFSA-N |
| XLogP | 6.17 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.48 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|