C33H25BrN2O5 — CID 98106263
phenacyl 2-[4-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-6-bromoquinoline-4-carboxylate (PubChem CID 98106263) has the molecular formula C33H25BrN2O5 and a molecular weight of 609.48 g/mol. Its IUPAC name is phenacyl 2-[4-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-6-bromoquinoline-4-carboxylate.
| Compound Name | phenacyl 2-[4-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-6-bromoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 98106263 |
| Molecular Formula | C33H25BrN2O5 |
| Molecular Weight | 609.48 g/mol |
| Exact Mass | 608.09 |
| IUPAC Name | phenacyl 2-[4-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-6-bromoquinoline-4-carboxylate |
| SMILES | C[C@@H]1C=CC[C@H]2C(=O)N(c3ccc(-c4cc(C(=O)OCC(=O)c5ccccc5)c5cc(Br)ccc5n4)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C33H25BrN2O5/c1-19-6-5-9-24-30(19)32(39)36(31(24)38)23-13-10-20(11-14-23)28-17-26(25-16-22(34)12-15-27(25)35-28)33(40)41-18-29(37)21-7-3-2-4-8-21/h2-8,10-17,19,24,30H,9,18H2,1H3/t19-,24-,30-/m1/s1 |
| InChIKey | QUHLTBGZRMVKOF-BZEUYSDMSA-N |
| XLogP | 6.41 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|