C36H31BrN2O5 — CID 4299018
(1-oxo-1-phenylpentan-2-yl) 6-bromo-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4299018) has the molecular formula C36H31BrN2O5 and a molecular weight of 651.56 g/mol. Its IUPAC name is (1-oxo-1-phenylpentan-2-yl) 6-bromo-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylpentan-2-yl) 6-bromo-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4299018 |
| Molecular Formula | C36H31BrN2O5 |
| Molecular Weight | 651.56 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | (1-oxo-1-phenylpentan-2-yl) 6-bromo-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CCCC(OC(=O)c1cc(-c2ccc(N3C(=O)C4CC=CC(C)C4C3=O)cc2)nc2ccc(Br)cc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C36H31BrN2O5/c1-3-8-31(33(40)23-10-5-4-6-11-23)44-36(43)28-20-30(38-29-18-15-24(37)19-27(28)29)22-13-16-25(17-14-22)39-34(41)26-12-7-9-21(2)32(26)35(39)42/h4-7,9-11,13-21,26,31-32H,3,8,12H2,1-2H3 |
| InChIKey | UGXZBRIWEPIQAM-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.56 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|