C35H29ClN2O6 — CID 5160619
[1-(4-methoxyphenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 5160619) has the molecular formula C35H29ClN2O6 and a molecular weight of 609.08 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 5160619 |
| Molecular Formula | C35H29ClN2O6 |
| Molecular Weight | 609.08 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | COc1ccc(C(=O)C(C)OC(=O)c2cc(-c3ccc(N4C(=O)C5CC=CC(C)C5C4=O)cc3)nc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C35H29ClN2O6/c1-19-5-4-6-26-31(19)34(41)38(33(26)40)24-12-7-21(8-13-24)30-18-28(27-17-23(36)11-16-29(27)37-30)35(42)44-20(2)32(39)22-9-14-25(43-3)15-10-22/h4-5,7-20,26,31H,6H2,1-3H3 |
| InChIKey | NUSIIBGTWOZFJU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.08 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|