C42H36N2O6 — CID 4656955
[1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 6-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4656955) has the molecular formula C42H36N2O6 and a molecular weight of 664.76 g/mol. Its IUPAC name is [1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 6-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 6-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4656955 |
| Molecular Formula | C42H36N2O6 |
| Molecular Weight | 664.76 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | [1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 6-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)C5CC=CC(C)C5C4=O)cc3)cc(C(=O)OC(C)C(=O)c3ccc(OCc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C42H36N2O6/c1-25-12-21-36-34(22-25)35(42(48)50-27(3)39(45)30-15-19-32(20-16-30)49-24-28-9-5-4-6-10-28)23-37(43-36)29-13-17-31(18-14-29)44-40(46)33-11-7-8-26(2)38(33)41(44)47/h4-10,12-23,26-27,33,38H,11,24H2,1-3H3 |
| InChIKey | IMPNVNRLNPCIOJ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.76 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|