C42H33ClN2O6 — CID 5175641
[1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 6-chloro-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate (PubChem CID 5175641) has the molecular formula C42H33ClN2O6 and a molecular weight of 697.19 g/mol. Its IUPAC name is [1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 6-chloro-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 6-chloro-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 5175641 |
| Molecular Formula | C42H33ClN2O6 |
| Molecular Weight | 697.19 g/mol |
| Exact Mass | 696.20 |
| IUPAC Name | [1-oxo-1-(4-phenylmethoxyphenyl)propan-2-yl] 6-chloro-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC1=CC2CC1C1C(=O)N(c3ccc(-c4cc(C(=O)OC(C)C(=O)c5ccc(OCc6ccccc6)cc5)c5cc(Cl)ccc5n4)cc3)C(=O)C21 |
| InChI | InChI=1S/C42H33ClN2O6/c1-23-18-28-19-32(23)38-37(28)40(47)45(41(38)48)30-13-8-26(9-14-30)36-21-34(33-20-29(43)12-17-35(33)44-36)42(49)51-24(2)39(46)27-10-15-31(16-11-27)50-22-25-6-4-3-5-7-25/h3-18,20-21,24,28,32,37-38H,19,22H2,1-2H3 |
| InChIKey | MCODRHAOMAOKQO-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.19 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|