C33H27ClN2O5 — CID 3435095
(1-oxo-1-phenylpropan-2-yl) 6-chloro-2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3435095) has the molecular formula C33H27ClN2O5 and a molecular weight of 567.04 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 6-chloro-2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 6-chloro-2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3435095 |
| Molecular Formula | C33H27ClN2O5 |
| Molecular Weight | 567.04 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 6-chloro-2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC(OC(=O)c1cc(-c2ccc(N3C(=O)C4CCCCC4C3=O)cc2)nc2ccc(Cl)cc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C33H27ClN2O5/c1-19(30(37)21-7-3-2-4-8-21)41-33(40)27-18-29(35-28-16-13-22(34)17-26(27)28)20-11-14-23(15-12-20)36-31(38)24-9-5-6-10-25(24)32(36)39/h2-4,7-8,11-19,24-25H,5-6,9-10H2,1H3 |
| InChIKey | BBFQBDGKINWUKQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.04 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|