C33H20Cl2N2O5 — CID 4079372
[1-(4-chlorophenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4079372) has the molecular formula C33H20Cl2N2O5 and a molecular weight of 595.44 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4079372 |
| Molecular Formula | C33H20Cl2N2O5 |
| Molecular Weight | 595.44 g/mol |
| Exact Mass | 594.07 |
| IUPAC Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC(OC(=O)c1cc(-c2ccc(N3C(=O)c4ccccc4C3=O)cc2)nc2ccc(Cl)cc12)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H20Cl2N2O5/c1-18(30(38)20-6-10-21(34)11-7-20)42-33(41)27-17-29(36-28-15-12-22(35)16-26(27)28)19-8-13-23(14-9-19)37-31(39)24-4-2-3-5-25(24)32(37)40/h2-18H,1H3 |
| InChIKey | FVANUKZESSCREN-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.44 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|