C26H21NO3 — CID 1217833
[(2R)-1-oxo-1-phenylpropan-2-yl] 2-(4-methylphenyl)quinoline-4-carboxylate (PubChem CID 1217833) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is [(2R)-1-oxo-1-phenylpropan-2-yl] 2-(4-methylphenyl)quinoline-4-carboxylate.
| Compound Name | [(2R)-1-oxo-1-phenylpropan-2-yl] 2-(4-methylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 1217833 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [(2R)-1-oxo-1-phenylpropan-2-yl] 2-(4-methylphenyl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)O[C@H](C)C(=O)c3ccccc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H21NO3/c1-17-12-14-19(15-13-17)24-16-22(21-10-6-7-11-23(21)27-24)26(29)30-18(2)25(28)20-8-4-3-5-9-20/h3-16,18H,1-2H3/t18-/m1/s1 |
| InChIKey | LWQQQMAGLYQYBS-GOSISDBHSA-N |
| XLogP | 5.64 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |