C33H35NO3 — CID 3589925
[1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(4-hexylphenyl)-6-methylquinoline-4-carboxylate (PubChem CID 3589925) has the molecular formula C33H35NO3 and a molecular weight of 493.65 g/mol. Its IUPAC name is [1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(4-hexylphenyl)-6-methylquinoline-4-carboxylate.
| Compound Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(4-hexylphenyl)-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3589925 |
| Molecular Formula | C33H35NO3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 2-(4-hexylphenyl)-6-methylquinoline-4-carboxylate |
| SMILES | CCCCCCc1ccc(-c2cc(C(=O)OC(C)C(=O)c3ccc(C)cc3)c3cc(C)ccc3n2)cc1 |
| InChI | InChI=1S/C33H35NO3/c1-5-6-7-8-9-25-13-17-26(18-14-25)31-21-29(28-20-23(3)12-19-30(28)34-31)33(36)37-24(4)32(35)27-15-10-22(2)11-16-27/h10-21,24H,5-9H2,1-4H3 |
| InChIKey | VZPDGLNEPPRBDC-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|