C21H21NO2 — CID 3996403
6-butyl-2-(4-methylphenyl)quinoline-4-carboxylic acid (PubChem CID 3996403) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 6-butyl-2-(4-methylphenyl)quinoline-4-carboxylic acid.
| Compound Name | 6-butyl-2-(4-methylphenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3996403 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 6-butyl-2-(4-methylphenyl)quinoline-4-carboxylic acid |
| SMILES | CCCCc1ccc2nc(-c3ccc(C)cc3)cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C21H21NO2/c1-3-4-5-15-8-11-19-17(12-15)18(21(23)24)13-20(22-19)16-9-6-14(2)7-10-16/h6-13H,3-5H2,1-2H3,(H,23,24) |
| InChIKey | WHXKNZPPRMHXGF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |