C26H22INO3 — CID 170148625
2-[4-(4-butoxyphenyl)phenyl]-6-iodoquinoline-4-carboxylic acid (PubChem CID 170148625) has the molecular formula C26H22INO3 and a molecular weight of 523.37 g/mol. Its IUPAC name is 2-[4-(4-butoxyphenyl)phenyl]-6-iodoquinoline-4-carboxylic acid.
| Compound Name | 2-[4-(4-butoxyphenyl)phenyl]-6-iodoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 170148625 |
| Molecular Formula | C26H22INO3 |
| Molecular Weight | 523.37 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | 2-[4-(4-butoxyphenyl)phenyl]-6-iodoquinoline-4-carboxylic acid |
| SMILES | CCCCOc1ccc(-c2ccc(-c3cc(C(=O)O)c4cc(I)ccc4n3)cc2)cc1 |
| InChI | InChI=1S/C26H22INO3/c1-2-3-14-31-21-11-8-18(9-12-21)17-4-6-19(7-5-17)25-16-23(26(29)30)22-15-20(27)10-13-24(22)28-25/h4-13,15-16H,2-3,14H2,1H3,(H,29,30) |
| InChIKey | UQFGWVOHJBTBTF-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.37 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|