C24H19NO3 — CID 4711644
6-methyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylic acid (PubChem CID 4711644) has the molecular formula C24H19NO3 and a molecular weight of 369.42 g/mol. Its IUPAC name is 6-methyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylic acid.
| Compound Name | 6-methyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 4711644 |
| Molecular Formula | C24H19NO3 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 6-methyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylic acid |
| SMILES | Cc1ccc2nc(-c3ccc(OCc4ccccc4)cc3)cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C24H19NO3/c1-16-7-12-22-20(13-16)21(24(26)27)14-23(25-22)18-8-10-19(11-9-18)28-15-17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,26,27) |
| InChIKey | CQNXMBXFCOAWDD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |