C21H15NO3 — CID 168527201
2-[4-(furan-2-yl)phenyl]-6-methylquinoline-4-carboxylic acid (PubChem CID 168527201) has the molecular formula C21H15NO3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)phenyl]-6-methylquinoline-4-carboxylic acid.
| Compound Name | 2-[4-(furan-2-yl)phenyl]-6-methylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 168527201 |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-[4-(furan-2-yl)phenyl]-6-methylquinoline-4-carboxylic acid |
| SMILES | Cc1ccc2nc(-c3ccc(-c4ccco4)cc3)cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C21H15NO3/c1-13-4-9-18-16(11-13)17(21(23)24)12-19(22-18)14-5-7-15(8-6-14)20-3-2-10-25-20/h2-12H,1H3,(H,23,24) |
| InChIKey | UAOWEQMQVNOOND-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |