C21H20N2O2 — CID 168514407
6-methyl-2-(4-pyrrolidin-1-ylphenyl)quinoline-4-carboxylic acid (PubChem CID 168514407) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 6-methyl-2-(4-pyrrolidin-1-ylphenyl)quinoline-4-carboxylic acid.
| Compound Name | 6-methyl-2-(4-pyrrolidin-1-ylphenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 168514407 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 6-methyl-2-(4-pyrrolidin-1-ylphenyl)quinoline-4-carboxylic acid |
| SMILES | Cc1ccc2nc(-c3ccc(N4CCCC4)cc3)cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C21H20N2O2/c1-14-4-9-19-17(12-14)18(21(24)25)13-20(22-19)15-5-7-16(8-6-15)23-10-2-3-11-23/h4-9,12-13H,2-3,10-11H2,1H3,(H,24,25) |
| InChIKey | MOUNYSSVXFMUHC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |