C25H20N2O4 — CID 3666895
2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylic acid (PubChem CID 3666895) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylic acid.
| Compound Name | 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3666895 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylic acid |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)C5CC=CCC5C4=O)cc3)cc(C(=O)O)c2c1 |
| InChI | InChI=1S/C25H20N2O4/c1-14-6-11-21-19(12-14)20(25(30)31)13-22(26-21)15-7-9-16(10-8-15)27-23(28)17-4-2-3-5-18(17)24(27)29/h2-3,6-13,17-18H,4-5H2,1H3,(H,30,31) |
| InChIKey | CSTSPRRBUNBSEX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|