C34H30N2O5 — CID 98106419
phenacyl 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 98106419) has the molecular formula C34H30N2O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is phenacyl 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | phenacyl 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 98106419 |
| Molecular Formula | C34H30N2O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | phenacyl 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)[C@H]5C[C@@H](C)CC[C@H]5C4=O)cc3)cc(C(=O)OCC(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C34H30N2O5/c1-20-8-14-25-27(17-20)33(39)36(32(25)38)24-12-10-22(11-13-24)30-18-28(26-16-21(2)9-15-29(26)35-30)34(40)41-19-31(37)23-6-4-3-5-7-23/h3-7,9-13,15-16,18,20,25,27H,8,14,17,19H2,1-2H3/t20-,25+,27-/m0/s1 |
| InChIKey | GOFAOHCTQWOIHM-FESMNKHTSA-N |
| XLogP | 6.18 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|