C34H29ClN2O5 — CID 98106450
[2-(4-chlorophenyl)-2-oxoethyl] 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 98106450) has the molecular formula C34H29ClN2O5 and a molecular weight of 581.07 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 98106450 |
| Molecular Formula | C34H29ClN2O5 |
| Molecular Weight | 581.07 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)[C@H]5C[C@@H](C)CC[C@H]5C4=O)cc3)cc(C(=O)OCC(=O)c3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C34H29ClN2O5/c1-19-3-13-25-27(16-19)33(40)37(32(25)39)24-11-7-21(8-12-24)30-17-28(26-15-20(2)4-14-29(26)36-30)34(41)42-18-31(38)22-5-9-23(35)10-6-22/h4-12,14-15,17,19,25,27H,3,13,16,18H2,1-2H3/t19-,25+,27-/m0/s1 |
| InChIKey | FZNANNXEMUWWQS-UYDITSSVSA-N |
| XLogP | 6.83 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.07 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|