C34H25Br2ClN2O5 — CID 5085860
[2-(4-chlorophenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 5085860) has the molecular formula C34H25Br2ClN2O5 and a molecular weight of 736.84 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 5085860 |
| Molecular Formula | C34H25Br2ClN2O5 |
| Molecular Weight | 736.84 g/mol |
| Exact Mass | 733.98 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)C5C6CC(C(Br)C6Br)C5C4=O)cc3)cc(C(=O)OCC(=O)c3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C34H25Br2ClN2O5/c1-16-2-11-25-21(12-16)22(34(43)44-15-27(40)18-3-7-19(37)8-4-18)14-26(38-25)17-5-9-20(10-6-17)39-32(41)28-23-13-24(29(28)33(39)42)31(36)30(23)35/h2-12,14,23-24,28-31H,13,15H2,1H3 |
| InChIKey | HCZVJPICIPBIFV-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.84 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|