C34H25Br2N3O7 — CID 4169087
[2-(3-nitrophenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 4169087) has the molecular formula C34H25Br2N3O7 and a molecular weight of 747.40 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4169087 |
| Molecular Formula | C34H25Br2N3O7 |
| Molecular Weight | 747.40 g/mol |
| Exact Mass | 745.01 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)C5C6CC(C(Br)C6Br)C5C4=O)cc3)cc(C(=O)OCC(=O)c3cccc([N+](=O)[O-])c3)c2c1 |
| InChI | InChI=1S/C34H25Br2N3O7/c1-16-5-10-25-21(11-16)22(34(43)46-15-27(40)18-3-2-4-20(12-18)39(44)45)14-26(37-25)17-6-8-19(9-7-17)38-32(41)28-23-13-24(29(28)33(38)42)31(36)30(23)35/h2-12,14,23-24,28-31H,13,15H2,1H3 |
| InChIKey | AUZQEMLQZNPOTE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.40 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|