C34H24Br3N3O7 — CID 4129609
[2-(4-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 4129609) has the molecular formula C34H24Br3N3O7 and a molecular weight of 826.29 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4129609 |
| Molecular Formula | C34H24Br3N3O7 |
| Molecular Weight | 826.29 g/mol |
| Exact Mass | 822.92 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | Cc1cc(Br)cc2c(C(=O)OCC(=O)c3ccc([N+](=O)[O-])cc3)cc(-c3ccc(N4C(=O)C5C6CC(C(Br)C6Br)C5C4=O)cc3)nc12 |
| InChI | InChI=1S/C34H24Br3N3O7/c1-15-10-18(35)11-21-22(34(44)47-14-26(41)17-4-8-20(9-5-17)40(45)46)13-25(38-31(15)21)16-2-6-19(7-3-16)39-32(42)27-23-12-24(28(27)33(39)43)30(37)29(23)36/h2-11,13,23-24,27-30H,12,14H2,1H3 |
| InChIKey | VEDXHDMFFPJJCG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.29 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|