C36H30BrN3O7 — CID 4103495
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-ethylquinoline-4-carboxylate (PubChem CID 4103495) has the molecular formula C36H30BrN3O7 and a molecular weight of 696.55 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-ethylquinoline-4-carboxylate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-ethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4103495 |
| Molecular Formula | C36H30BrN3O7 |
| Molecular Weight | 696.55 g/mol |
| Exact Mass | 695.13 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-ethylquinoline-4-carboxylate |
| SMILES | CCc1cc(Br)cc2c(C(=O)OCC(=O)c3ccc(C)c([N+](=O)[O-])c3)cc(-c3ccc(N4C(=O)C5C6CCC(C6)C5C4=O)cc3)nc12 |
| InChI | InChI=1S/C36H30BrN3O7/c1-3-19-13-24(37)15-26-27(36(44)47-17-30(41)21-5-4-18(2)29(14-21)40(45)46)16-28(38-33(19)26)20-8-10-25(11-9-20)39-34(42)31-22-6-7-23(12-22)32(31)35(39)43/h4-5,8-11,13-16,22-23,31-32H,3,6-7,12,17H2,1-2H3 |
| InChIKey | KNUHCWKEROHJNG-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.55 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|