C35H27BrN2O6 — CID 4612640
[2-(4-methoxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 4612640) has the molecular formula C35H27BrN2O6 and a molecular weight of 651.51 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4612640 |
| Molecular Formula | C35H27BrN2O6 |
| Molecular Weight | 651.51 g/mol |
| Exact Mass | 650.11 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)C5C6C=CC(C6)C5C4=O)cc3)nc3c(C)cc(Br)cc23)cc1 |
| InChI | InChI=1S/C35H27BrN2O6/c1-18-13-23(36)15-26-27(35(42)44-17-29(39)20-7-11-25(43-2)12-8-20)16-28(37-32(18)26)19-5-9-24(10-6-19)38-33(40)30-21-3-4-22(14-21)31(30)34(38)41/h3-13,15-16,21-22,30-31H,14,17H2,1-2H3 |
| InChIKey | QONJSJSWEOYGNG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|