C36H29BrN2O5 — CID 19646699
(1-oxo-1-phenylbutan-2-yl) 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 19646699) has the molecular formula C36H29BrN2O5 and a molecular weight of 649.54 g/mol. Its IUPAC name is (1-oxo-1-phenylbutan-2-yl) 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylbutan-2-yl) 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19646699 |
| Molecular Formula | C36H29BrN2O5 |
| Molecular Weight | 649.54 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | (1-oxo-1-phenylbutan-2-yl) 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | CCC(OC(=O)c1cc(-c2ccc(N3C(=O)C4C5C=CC(C5)C4C3=O)cc2)nc2c(C)cc(Br)cc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C36H29BrN2O5/c1-3-29(33(40)21-7-5-4-6-8-21)44-36(43)27-18-28(38-32-19(2)15-24(37)17-26(27)32)20-11-13-25(14-12-20)39-34(41)30-22-9-10-23(16-22)31(30)35(39)42/h4-15,17-18,22-23,29-31H,3,16H2,1-2H3 |
| InChIKey | XHJMDLABHWVFST-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.54 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|