C27H22BrNO3 — CID 41284542
[(2R)-1-oxo-1-phenylbutan-2-yl] 2-(4-bromophenyl)-8-methylquinoline-4-carboxylate (PubChem CID 41284542) has the molecular formula C27H22BrNO3 and a molecular weight of 488.38 g/mol. Its IUPAC name is [(2R)-1-oxo-1-phenylbutan-2-yl] 2-(4-bromophenyl)-8-methylquinoline-4-carboxylate.
| Compound Name | [(2R)-1-oxo-1-phenylbutan-2-yl] 2-(4-bromophenyl)-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 41284542 |
| Molecular Formula | C27H22BrNO3 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | [(2R)-1-oxo-1-phenylbutan-2-yl] 2-(4-bromophenyl)-8-methylquinoline-4-carboxylate |
| SMILES | CC[C@@H](OC(=O)c1cc(-c2ccc(Br)cc2)nc2c(C)cccc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H22BrNO3/c1-3-24(26(30)19-9-5-4-6-10-19)32-27(31)22-16-23(18-12-14-20(28)15-13-18)29-25-17(2)8-7-11-21(22)25/h4-16,24H,3H2,1-2H3/t24-/m1/s1 |
| InChIKey | HMPRBDLBZJZXSO-XMMPIXPASA-N |
| XLogP | 6.79 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |