C37H32N2O5 — CID 4564884
(1-oxo-1-phenylpentan-2-yl) 2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 4564884) has the molecular formula C37H32N2O5 and a molecular weight of 584.67 g/mol. Its IUPAC name is (1-oxo-1-phenylpentan-2-yl) 2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylpentan-2-yl) 2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4564884 |
| Molecular Formula | C37H32N2O5 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | (1-oxo-1-phenylpentan-2-yl) 2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | CCCC(OC(=O)c1cc(-c2ccc(N3C(=O)C4C5C=CC(C5)C4C3=O)cc2)nc2c(C)cccc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C37H32N2O5/c1-3-8-30(34(40)23-10-5-4-6-11-23)44-37(43)28-20-29(38-33-21(2)9-7-12-27(28)33)22-15-17-26(18-16-22)39-35(41)31-24-13-14-25(19-24)32(31)36(39)42/h4-7,9-18,20,24-25,30-32H,3,8,19H2,1-2H3 |
| InChIKey | IRPZWVOHXAEGBF-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|