C36H32N2O5 — CID 5199381
(1-oxo-1-phenylpentan-2-yl) 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 5199381) has the molecular formula C36H32N2O5 and a molecular weight of 572.66 g/mol. Its IUPAC name is (1-oxo-1-phenylpentan-2-yl) 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylpentan-2-yl) 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 5199381 |
| Molecular Formula | C36H32N2O5 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | (1-oxo-1-phenylpentan-2-yl) 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | CCCC(OC(=O)c1cc(-c2ccc(N3C(=O)C4CC=CCC4C3=O)cc2)nc2c(C)cccc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C36H32N2O5/c1-3-10-31(33(39)24-12-5-4-6-13-24)43-36(42)29-21-30(37-32-22(2)11-9-16-26(29)32)23-17-19-25(20-18-23)38-34(40)27-14-7-8-15-28(27)35(38)41/h4-9,11-13,16-21,27-28,31H,3,10,14-15H2,1-2H3 |
| InChIKey | NKBMPDYFTLRRJU-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|