C35H25ClN2O5 — CID 3268232
(1-oxo-1-phenylpentan-2-yl) 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3268232) has the molecular formula C35H25ClN2O5 and a molecular weight of 589.05 g/mol. Its IUPAC name is (1-oxo-1-phenylpentan-2-yl) 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylpentan-2-yl) 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3268232 |
| Molecular Formula | C35H25ClN2O5 |
| Molecular Weight | 589.05 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | (1-oxo-1-phenylpentan-2-yl) 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CCCC(OC(=O)c1cc(-c2ccc(N3C(=O)c4ccccc4C3=O)cc2)nc2ccc(Cl)cc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H25ClN2O5/c1-2-8-31(32(39)22-9-4-3-5-10-22)43-35(42)28-20-30(37-29-18-15-23(36)19-27(28)29)21-13-16-24(17-14-21)38-33(40)25-11-6-7-12-26(25)34(38)41/h3-7,9-20,31H,2,8H2,1H3 |
| InChIKey | NEHRCCULJHNWQR-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.05 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|