C34H23ClN2O5 — CID 4549346
[2-(3,4-dimethylphenyl)-2-oxoethyl] 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4549346) has the molecular formula C34H23ClN2O5 and a molecular weight of 575.02 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4549346 |
| Molecular Formula | C34H23ClN2O5 |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 6-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)c5ccccc5C4=O)cc3)nc3ccc(Cl)cc23)cc1C |
| InChI | InChI=1S/C34H23ClN2O5/c1-19-7-8-22(15-20(19)2)31(38)18-42-34(41)28-17-30(36-29-14-11-23(35)16-27(28)29)21-9-12-24(13-10-21)37-32(39)25-5-3-4-6-26(25)33(37)40/h3-17H,18H2,1-2H3 |
| InChIKey | LXGPWRZLVWCSGR-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|