C32H23ClN2O5 — CID 4518000
phenacyl 6-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4518000) has the molecular formula C32H23ClN2O5 and a molecular weight of 551.00 g/mol. Its IUPAC name is phenacyl 6-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | phenacyl 6-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4518000 |
| Molecular Formula | C32H23ClN2O5 |
| Molecular Weight | 551.00 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | phenacyl 6-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(N3C(=O)C4CC=CCC4C3=O)cc2)nc2ccc(Cl)cc12)c1ccccc1 |
| InChI | InChI=1S/C32H23ClN2O5/c33-21-12-15-27-25(16-21)26(32(39)40-18-29(36)20-6-2-1-3-7-20)17-28(34-27)19-10-13-22(14-11-19)35-30(37)23-8-4-5-9-24(23)31(35)38/h1-7,10-17,23-24H,8-9,18H2 |
| InChIKey | WKKJBFZWKQHOHF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.00 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|