C33H25ClN2O6 — CID 3392092
[2-(4-methoxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3392092) has the molecular formula C33H25ClN2O6 and a molecular weight of 581.02 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3392092 |
| Molecular Formula | C33H25ClN2O6 |
| Molecular Weight | 581.02 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)C5CC=CCC5C4=O)cc3)nc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C33H25ClN2O6/c1-41-23-13-8-20(9-14-23)30(37)18-42-33(40)27-17-29(35-28-15-10-21(34)16-26(27)28)19-6-11-22(12-7-19)36-31(38)24-4-2-3-5-25(24)32(36)39/h2-3,6-17,24-25H,4-5,18H2,1H3 |
| InChIKey | LHPJFJPWBMJWBZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.02 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|