C34H29ClN2O6 — CID 3360651
[2-(4-methoxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3360651) has the molecular formula C34H29ClN2O6 and a molecular weight of 597.07 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3360651 |
| Molecular Formula | C34H29ClN2O6 |
| Molecular Weight | 597.07 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)C5CCC(C)CC5C4=O)cc3)nc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C34H29ClN2O6/c1-19-3-13-25-27(15-19)33(40)37(32(25)39)23-9-4-20(5-10-23)30-17-28(26-16-22(35)8-14-29(26)36-30)34(41)43-18-31(38)21-6-11-24(42-2)12-7-21/h4-12,14,16-17,19,25,27H,3,13,15,18H2,1-2H3 |
| InChIKey | AJNGVBSFGPZGTD-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.07 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|