C33H25BrCl2N2O5 — CID 4991585
[2-(2,4-dichlorophenyl)-2-oxoethyl] 6-bromo-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4991585) has the molecular formula C33H25BrCl2N2O5 and a molecular weight of 680.38 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 6-bromo-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 6-bromo-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4991585 |
| Molecular Formula | C33H25BrCl2N2O5 |
| Molecular Weight | 680.38 g/mol |
| Exact Mass | 678.03 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 6-bromo-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC1CCC2C(=O)N(c3ccc(-c4cc(C(=O)OCC(=O)c5ccc(Cl)cc5Cl)c5cc(Br)ccc5n4)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C33H25BrCl2N2O5/c1-17-2-9-22-25(12-17)32(41)38(31(22)40)21-7-3-18(4-8-21)29-15-26(24-13-19(34)5-11-28(24)37-29)33(42)43-16-30(39)23-10-6-20(35)14-27(23)36/h3-8,10-11,13-15,17,22,25H,2,9,12,16H2,1H3 |
| InChIKey | HVWCIINTAFISEB-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.38 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|