C33H21Br2Cl3N2O5 — CID 3339395
[2-(2,4-dichlorophenyl)-2-oxoethyl] 6-chloro-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3339395) has the molecular formula C33H21Br2Cl3N2O5 and a molecular weight of 791.71 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 6-chloro-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 6-chloro-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3339395 |
| Molecular Formula | C33H21Br2Cl3N2O5 |
| Molecular Weight | 791.71 g/mol |
| Exact Mass | 787.89 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 6-chloro-2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(N3C(=O)C4C5CC(C(Br)C5Br)C4C3=O)cc2)nc2ccc(Cl)cc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H21Br2Cl3N2O5/c34-29-21-11-22(30(29)35)28-27(21)31(42)40(32(28)43)17-5-1-14(2-6-17)25-12-20(19-9-15(36)4-8-24(19)39-25)33(44)45-13-26(41)18-7-3-16(37)10-23(18)38/h1-10,12,21-22,27-30H,11,13H2 |
| InChIKey | PACIKTXRSTZWDK-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.71 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|