C31H21ClN2O5S — CID 4246567
(2-oxo-2-thiophen-2-ylethyl) 6-chloro-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4246567) has the molecular formula C31H21ClN2O5S and a molecular weight of 569.04 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 6-chloro-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 6-chloro-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4246567 |
| Molecular Formula | C31H21ClN2O5S |
| Molecular Weight | 569.04 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 6-chloro-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(N3C(=O)C4C5C=CC(C5)C4C3=O)cc2)nc2ccc(Cl)cc12)c1cccs1 |
| InChI | InChI=1S/C31H21ClN2O5S/c32-19-7-10-23-21(13-19)22(31(38)39-15-25(35)26-2-1-11-40-26)14-24(33-23)16-5-8-20(9-6-16)34-29(36)27-17-3-4-18(12-17)28(27)30(34)37/h1-11,13-14,17-18,27-28H,12,15H2 |
| InChIKey | IJOGZCJZBZZHED-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.04 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|