C34H26N2O5 — CID 3290944
phenacyl 2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 3290944) has the molecular formula C34H26N2O5 and a molecular weight of 542.59 g/mol. Its IUPAC name is phenacyl 2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | phenacyl 2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3290944 |
| Molecular Formula | C34H26N2O5 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | phenacyl 2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)C5C6C=CC(C6)C5C4=O)cc3)cc(C(=O)OCC(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C34H26N2O5/c1-19-7-14-27-25(15-19)26(34(40)41-18-29(37)21-5-3-2-4-6-21)17-28(35-27)20-10-12-24(13-11-20)36-32(38)30-22-8-9-23(16-22)31(30)33(36)39/h2-15,17,22-23,30-31H,16,18H2,1H3 |
| InChIKey | VTSHTZNUAUVHCX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|