C33H25BrN2O5 — CID 4067730
phenacyl 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4067730) has the molecular formula C33H25BrN2O5 and a molecular weight of 609.48 g/mol. Its IUPAC name is phenacyl 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | phenacyl 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4067730 |
| Molecular Formula | C33H25BrN2O5 |
| Molecular Weight | 609.48 g/mol |
| Exact Mass | 608.09 |
| IUPAC Name | phenacyl 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(N3C(=O)C4C5CCC(C5)C4C3=O)cc2)nc2ccc(Br)cc12)c1ccccc1 |
| InChI | InChI=1S/C33H25BrN2O5/c34-22-10-13-26-24(15-22)25(33(40)41-17-28(37)19-4-2-1-3-5-19)16-27(35-26)18-8-11-23(12-9-18)36-31(38)29-20-6-7-21(14-20)30(29)32(36)39/h1-5,8-13,15-16,20-21,29-30H,6-7,14,17H2 |
| InChIKey | COAIOJOLEABWIH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|