C32H23Br2ClN2O6 — CID 4047890
[2-(2-hydroxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4047890) has the molecular formula C32H23Br2ClN2O6 and a molecular weight of 726.80 g/mol. Its IUPAC name is [2-(2-hydroxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(2-hydroxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4047890 |
| Molecular Formula | C32H23Br2ClN2O6 |
| Molecular Weight | 726.80 g/mol |
| Exact Mass | 723.96 |
| IUPAC Name | [2-(2-hydroxyphenyl)-2-oxoethyl] 6-chloro-2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(N3C(=O)C4CC(Br)C(Br)CC4C3=O)cc2)nc2ccc(Cl)cc12)c1ccccc1O |
| InChI | InChI=1S/C32H23Br2ClN2O6/c33-24-12-21-22(13-25(24)34)31(41)37(30(21)40)18-8-5-16(6-9-18)27-14-23(20-11-17(35)7-10-26(20)36-27)32(42)43-15-29(39)19-3-1-2-4-28(19)38/h1-11,14,21-22,24-25,38H,12-13,15H2 |
| InChIKey | ZAZQRZLCQMKXTC-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.80 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|