C32H23BrN2O6 — CID 3454382
[2-(2-hydroxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3454382) has the molecular formula C32H23BrN2O6 and a molecular weight of 611.45 g/mol. Its IUPAC name is [2-(2-hydroxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(2-hydroxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3454382 |
| Molecular Formula | C32H23BrN2O6 |
| Molecular Weight | 611.45 g/mol |
| Exact Mass | 610.07 |
| IUPAC Name | [2-(2-hydroxyphenyl)-2-oxoethyl] 6-bromo-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(N3C(=O)C4CC=CCC4C3=O)cc2)nc2ccc(Br)cc12)c1ccccc1O |
| InChI | InChI=1S/C32H23BrN2O6/c33-19-11-14-26-24(15-19)25(32(40)41-17-29(37)23-7-3-4-8-28(23)36)16-27(34-26)18-9-12-20(13-10-18)35-30(38)21-5-1-2-6-22(21)31(35)39/h1-4,7-16,21-22,36H,5-6,17H2 |
| InChIKey | NFLCVJLGNGFMGC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|