C33H24Br2ClN3O7 — CID 4695032
[2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 4695032) has the molecular formula C33H24Br2ClN3O7 and a molecular weight of 769.83 g/mol. Its IUPAC name is [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4695032 |
| Molecular Formula | C33H24Br2ClN3O7 |
| Molecular Weight | 769.83 g/mol |
| Exact Mass | 766.97 |
| IUPAC Name | [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 2-[4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)C5CC(Br)C(Br)CC5C4=O)cc3)cc(C(=O)OCC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c2c1 |
| InChI | InChI=1S/C33H24Br2ClN3O7/c1-16-2-9-27-20(10-16)23(33(43)46-15-30(40)18-5-8-26(36)29(11-18)39(44)45)14-28(37-27)17-3-6-19(7-4-17)38-31(41)21-12-24(34)25(35)13-22(21)32(38)42/h2-11,14,21-22,24-25H,12-13,15H2,1H3 |
| InChIKey | IJMFFZUPOXGJLD-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.83 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|