C35H26ClN3O7 — CID 5121870
[2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 6-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate (PubChem CID 5121870) has the molecular formula C35H26ClN3O7 and a molecular weight of 636.06 g/mol. Its IUPAC name is [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 6-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 6-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 5121870 |
| Molecular Formula | C35H26ClN3O7 |
| Molecular Weight | 636.06 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 6-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC1=CC2CC1C1C(=O)N(c3ccc(-c4cc(C(=O)OCC(=O)c5ccc(Cl)c([N+](=O)[O-])c5)c5cc(C)ccc5n4)cc3)C(=O)C21 |
| InChI | InChI=1S/C35H26ClN3O7/c1-17-3-10-27-24(11-17)25(35(43)46-16-30(40)20-6-9-26(36)29(14-20)39(44)45)15-28(37-27)19-4-7-22(8-5-19)38-33(41)31-21-12-18(2)23(13-21)32(31)34(38)42/h3-12,14-15,21,23,31-32H,13,16H2,1-2H3 |
| InChIKey | JFFHAGIONUFBMF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.06 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|