C34H24BrCl2N3O7 — CID 4116605
[2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 6-bromo-7-chloro-8-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4116605) has the molecular formula C34H24BrCl2N3O7 and a molecular weight of 737.39 g/mol. Its IUPAC name is [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 6-bromo-7-chloro-8-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 6-bromo-7-chloro-8-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4116605 |
| Molecular Formula | C34H24BrCl2N3O7 |
| Molecular Weight | 737.39 g/mol |
| Exact Mass | 735.02 |
| IUPAC Name | [2-(4-chloro-3-nitrophenyl)-2-oxoethyl] 6-bromo-7-chloro-8-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | Cc1c(Cl)c(Br)cc2c(C(=O)OCC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)cc(-c3ccc(N4C(=O)C5CC=CC(C)C5C4=O)cc3)nc12 |
| InChI | InChI=1S/C34H24BrCl2N3O7/c1-16-4-3-5-21-29(16)33(43)39(32(21)42)20-9-6-18(7-10-20)26-14-23(22-13-24(35)30(37)17(2)31(22)38-26)34(44)47-15-28(41)19-8-11-25(36)27(12-19)40(45)46/h3-4,6-14,16,21,29H,5,15H2,1-2H3 |
| InChIKey | JPFUQUZGYCPYEO-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.39 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|