C35H28BrClN2O5 — CID 5086324
[2-(3,4-dimethylphenyl)-2-oxoethyl] 6-bromo-7-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 5086324) has the molecular formula C35H28BrClN2O5 and a molecular weight of 671.98 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] 6-bromo-7-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 6-bromo-7-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 5086324 |
| Molecular Formula | C35H28BrClN2O5 |
| Molecular Weight | 671.98 g/mol |
| Exact Mass | 670.09 |
| IUPAC Name | [2-(3,4-dimethylphenyl)-2-oxoethyl] 6-bromo-7-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)C5CC=CCC5C4=O)cc3)nc3c(C)c(Cl)c(Br)cc23)cc1C |
| InChI | InChI=1S/C35H28BrClN2O5/c1-18-8-9-22(14-19(18)2)30(40)17-44-35(43)27-16-29(38-32-20(3)31(37)28(36)15-26(27)32)21-10-12-23(13-11-21)39-33(41)24-6-4-5-7-25(24)34(39)42/h4-5,8-16,24-25H,6-7,17H2,1-3H3 |
| InChIKey | NFVRWOQSSFIIMD-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.98 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|