C33H23BrClN3O7 — CID 5161790
[2-(4-nitrophenyl)-2-oxoethyl] 6-bromo-7-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 5161790) has the molecular formula C33H23BrClN3O7 and a molecular weight of 688.92 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 6-bromo-7-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 6-bromo-7-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 5161790 |
| Molecular Formula | C33H23BrClN3O7 |
| Molecular Weight | 688.92 g/mol |
| Exact Mass | 687.04 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 6-bromo-7-chloro-2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | Cc1c(Cl)c(Br)cc2c(C(=O)OCC(=O)c3ccc([N+](=O)[O-])cc3)cc(-c3ccc(N4C(=O)C5CC=CCC5C4=O)cc3)nc12 |
| InChI | InChI=1S/C33H23BrClN3O7/c1-17-29(35)26(34)14-24-25(33(42)45-16-28(39)19-8-12-21(13-9-19)38(43)44)15-27(36-30(17)24)18-6-10-20(11-7-18)37-31(40)22-4-2-3-5-23(22)32(37)41/h2-3,6-15,22-23H,4-5,16H2,1H3 |
| InChIKey | QKBLUFKFUZBCML-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.92 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|